ChemNet > CAS > 5307-99-3 7,7-Dichlorobicyclo(3.2.0)hept-2-en-6-one
5307-99-3 7,7-Dichlorobicyclo(3.2.0)hept-2-en-6-one
| product Name |
7,7-Dichlorobicyclo(3.2.0)hept-2-en-6-one |
| CAS No |
5307-99-3 |
| Synonyms |
Dichlorobicycloheptenone; 7,7-Dichlorobicyclo[3.2.0]hept-2-en-6-one; (1R,5R)-7,7-dichlorobicyclo[3.2.0]hept-2-en-6-one; (1S,5S)-7,7-dichlorobicyclo[3.2.0]hept-2-en-6-one; (1R,5S)-7,7-dichlorobicyclo[3.2.0]hept-2-en-6-one; (1S,5R)-7,7-dichlorobicyclo[3.2.0]hept-2-en-6-one |
| Molecular Formula |
C7H6Cl2O |
| Molecular Weight |
177.0279 |
| InChI |
InChI=1/C7H6Cl2O/c8-7(9)5-3-1-2-4(5)6(7)10/h1,3-5H,2H2/t4-,5+/m1/s1 |
| EINECS |
226-165-0 |
| Molecular Structure |
|
| Density |
1.44g/cm3 |
| Boiling point |
274.8°C at 760 mmHg |
| Refractive index |
1.568 |
| Flash point |
114.1°C |
| Vapour Pressur |
0.0053mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
